C14H24IN3OS — CID 109486841
N,2-diethyl-N'-(furan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486841) has the molecular formula C14H24IN3OS and a molecular weight of 409.34 g/mol. Its IUPAC name is N,2-diethyl-N'-(furan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-(furan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486841 |
| Molecular Formula | C14H24IN3OS |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N,2-diethyl-N'-(furan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C14H23N3OS.HI/c1-3-13-11-17(7-9-19-13)14(15-4-2)16-10-12-6-5-8-18-12;/h5-6,8,13H,3-4,7,9-11H2,1-2H3,(H,15,16);1H |
| InChIKey | YCGNSYQTOHLGAM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|