C14H23N3S2 — CID 109485860
N,2-diethyl-N'-(thiophen-2-ylmethyl)thiomorpholine-4-carboximidamide (PubChem CID 109485860) has the molecular formula C14H23N3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is N,2-diethyl-N'-(thiophen-2-ylmethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-(thiophen-2-ylmethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485860 |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N,2-diethyl-N'-(thiophen-2-ylmethyl)thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccs1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C14H23N3S2/c1-3-12-11-17(7-9-19-12)14(15-4-2)16-10-13-6-5-8-18-13/h5-6,8,12H,3-4,7,9-11H2,1-2H3,(H,15,16) |
| InChIKey | ACQZSAMWGQBFNP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|