C17H24N4OS2 — CID 109486174
N,2-diethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109486174) has the molecular formula C17H24N4OS2 and a molecular weight of 364.54 g/mol. Its IUPAC name is N,2-diethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486174 |
| Molecular Formula | C17H24N4OS2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N,2-diethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C17H24N4OS2/c1-3-14-11-21(7-9-23-14)17(18-4-2)19-10-13-12-22-16(20-13)15-6-5-8-24-15/h5-6,8,12,14H,3-4,7,9-11H2,1-2H3,(H,18,19) |
| InChIKey | UUHZPFRASODTRM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|