C15H24IN5S2 — CID 109486609
N,2-diethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486609) has the molecular formula C15H24IN5S2 and a molecular weight of 465.43 g/mol. Its IUPAC name is N,2-diethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486609 |
| Molecular Formula | C15H24IN5S2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N,2-diethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C15H23N5S2.HI/c1-3-13-11-19(5-7-21-13)14(16-4-2)17-9-12-10-20-6-8-22-15(20)18-12;/h6,8,10,13H,3-5,7,9,11H2,1-2H3,(H,16,17);1H |
| InChIKey | HSYKZYSFARKJMU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|