C15H22N6OS — CID 110963229
4-acetyl-N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide (PubChem CID 110963229) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963229 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C15H22N6OS/c1-3-16-14(20-6-4-19(5-7-20)12(2)22)17-10-13-11-21-8-9-23-15(21)18-13/h8-9,11H,3-7,10H2,1-2H3,(H,16,17) |
| InChIKey | DIXUMNGKBWOWRC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 65.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|