C16H24N6O2S — CID 111163529
ethyl 4-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163529) has the molecular formula C16H24N6O2S and a molecular weight of 364.48 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163529 |
| Molecular Formula | C16H24N6O2S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H24N6O2S/c1-3-17-14(18-11-13-12-22-9-10-25-15(22)19-13)20-5-7-21(8-6-20)16(23)24-4-2/h9-10,12H,3-8,11H2,1-2H3,(H,17,18) |
| InChIKey | BIRKTKSRJGDJEI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|