C19H23FN6S — CID 111148651
N-ethyl-4-(2-fluorophenyl)-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111148651) has the molecular formula C19H23FN6S and a molecular weight of 386.50 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148651 |
| Molecular Formula | C19H23FN6S |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H23FN6S/c1-2-21-18(22-13-15-14-26-11-12-27-19(26)23-15)25-9-7-24(8-10-25)17-6-4-3-5-16(17)20/h3-6,11-12,14H,2,7-10,13H2,1H3,(H,21,22) |
| InChIKey | ASXDEKYDDLZQSC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|