C18H28N6O2S — CID 111730497
tert-butyl N-[1-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730497) has the molecular formula C18H28N6O2S and a molecular weight of 392.53 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730497 |
| Molecular Formula | C18H28N6O2S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1cn2ccsc2n1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H28N6O2S/c1-5-19-15(20-10-14-12-24-8-9-27-16(24)21-14)23-7-6-13(11-23)22-17(25)26-18(2,3)4/h8-9,12-13H,5-7,10-11H2,1-4H3,(H,19,20)(H,22,25) |
| InChIKey | WQMXBPLJLIDWAL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|