C15H26N4S2 — CID 109485344
N,2-diethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109485344) has the molecular formula C15H26N4S2 and a molecular weight of 326.54 g/mol. Its IUPAC name is N,2-diethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485344 |
| Molecular Formula | C15H26N4S2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N,2-diethyl-N'-[(2-ethyl-1,3-thiazol-4-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1csc(CC)n1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C15H26N4S2/c1-4-13-10-19(7-8-20-13)15(16-6-3)17-9-12-11-21-14(5-2)18-12/h11,13H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | ALIHXQIKJIJMOZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|