C17H30N4OS — CID 109486994
N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109486994) has the molecular formula C17H30N4OS and a molecular weight of 338.52 g/mol. Its IUPAC name is N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486994 |
| Molecular Formula | C17H30N4OS |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)N1CCSC(CC)C1 |
| InChI | InChI=1S/C17H30N4OS/c1-6-13-12-21(8-9-23-13)16(18-7-2)20-11-15-19-10-14(22-15)17(3,4)5/h10,13H,6-9,11-12H2,1-5H3,(H,18,20) |
| InChIKey | LJKZMWMVPBBKAP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|