C16H29IN4OS — CID 109485305
N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485305) has the molecular formula C16H29IN4OS and a molecular weight of 452.41 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485305 |
| Molecular Formula | C16H29IN4OS |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCc2ncc(C(C)(C)C)o2)CCS1.I |
| InChI | InChI=1S/C16H28N4OS.HI/c1-6-12-11-20(7-8-22-12)15(17-5)19-10-14-18-9-13(21-14)16(2,3)4;/h9,12H,6-8,10-11H2,1-5H3,(H,17,19);1H |
| InChIKey | BMLSAWKULQYZGP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|