C18H30IN3O3S — CID 109486303
2-ethyl-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486303) has the molecular formula C18H30IN3O3S and a molecular weight of 495.43 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486303 |
| Molecular Formula | C18H30IN3O3S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N\C)NCc2c(OC)cc(OC)cc2OC)CCS1.I |
| InChI | InChI=1S/C18H29N3O3S.HI/c1-6-14-12-21(7-8-25-14)18(19-2)20-11-15-16(23-4)9-13(22-3)10-17(15)24-5;/h9-10,14H,6-8,11-12H2,1-5H3,(H,19,20);1H |
| InChIKey | LYWDNDKEXJLMPJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|