C20H33N3O5 — CID 111747613
3-(2-methoxyethoxymethyl)-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111747613) has the molecular formula C20H33N3O5 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747613 |
| Molecular Formula | C20H33N3O5 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1c(OC)cc(OC)cc1OC)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H33N3O5/c1-21-20(23-7-6-15(13-23)14-28-9-8-24-2)22-12-17-18(26-4)10-16(25-3)11-19(17)27-5/h10-11,15H,6-9,12-14H2,1-5H3,(H,21,22) |
| InChIKey | PHKAPMUKMMRURR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|