C25H36IN3O4 — CID 111746799
3-(2-methoxyethoxymethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746799) has the molecular formula C25H36IN3O4 and a molecular weight of 569.48 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746799 |
| Molecular Formula | C25H36IN3O4 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCc2ccccc2)c(OC)c1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C25H35N3O4.HI/c1-26-25(28-12-11-22(17-28)18-31-14-13-29-2)27-16-21-9-10-23(24(15-21)30-3)32-19-20-7-5-4-6-8-20;/h4-10,15,22H,11-14,16-19H2,1-3H3,(H,26,27);1H |
| InChIKey | RBPZRHWZXVJFEM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|