C19H30F2IN3O3 — CID 111747990
N-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111747990) has the molecular formula C19H30F2IN3O3 and a molecular weight of 513.37 g/mol. Its IUPAC name is N-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111747990 |
| Molecular Formula | C19H30F2IN3O3 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)F)c1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C19H29F2N3O3.HI/c1-22-19(24-7-6-16(12-24)13-26-9-8-25-2)23-11-15-4-3-5-17(10-15)27-14-18(20)21;/h3-5,10,16,18H,6-9,11-14H2,1-2H3,(H,22,23);1H |
| InChIKey | BZSVGTKWMXPUNV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|