C22H27F2N3O2 — CID 111527193
N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111527193) has the molecular formula C22H27F2N3O2 and a molecular weight of 403.47 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111527193 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc(OC(F)F)c1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C22H27F2N3O2/c1-25-22(26-13-18-8-5-9-20(12-18)29-21(23)24)27-11-10-19(14-27)16-28-15-17-6-3-2-4-7-17/h2-9,12,19,21H,10-11,13-16H2,1H3,(H,25,26) |
| InChIKey | JZNFGGVTCAYMQN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|