C24H31F3IN3O2 — CID 111526758
N'-methyl-3-(phenylmethoxymethyl)-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111526758) has the molecular formula C24H31F3IN3O2 and a molecular weight of 577.43 g/mol. Its IUPAC name is N'-methyl-3-(phenylmethoxymethyl)-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-3-(phenylmethoxymethyl)-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111526758 |
| Molecular Formula | C24H31F3IN3O2 |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | N'-methyl-3-(phenylmethoxymethyl)-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(COCC(F)(F)F)cc1)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C24H30F3N3O2.HI/c1-28-23(29-13-19-7-9-21(10-8-19)16-32-18-24(25,26)27)30-12-11-22(14-30)17-31-15-20-5-3-2-4-6-20;/h2-10,22H,11-18H2,1H3,(H,28,29);1H |
| InChIKey | VWIURUVWYWUSCL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|