C23H31IN4O3 — CID 111525727
methyl N-[4-[[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111525727) has the molecular formula C23H31IN4O3 and a molecular weight of 538.43 g/mol. Its IUPAC name is methyl N-[4-[[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111525727 |
| Molecular Formula | C23H31IN4O3 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | methyl N-[4-[[[N-methyl-C-[3-(phenylmethoxymethyl)pyrrolidin-1-yl]carbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NC(=O)OC)cc1)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C23H30N4O3.HI/c1-24-22(25-14-18-8-10-21(11-9-18)26-23(28)29-2)27-13-12-20(15-27)17-30-16-19-6-4-3-5-7-19;/h3-11,20H,12-17H2,1-2H3,(H,24,25)(H,26,28);1H |
| InChIKey | UVKCEWQSTJEAPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|