C19H25BrIN3OS — CID 111525735
N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111525735) has the molecular formula C19H25BrIN3OS and a molecular weight of 550.30 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111525735 |
| Molecular Formula | C19H25BrIN3OS |
| Molecular Weight | 550.30 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-methyl-3-(phenylmethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Br)cs1)N1CCC(COCc2ccccc2)C1.I |
| InChI | InChI=1S/C19H24BrN3OS.HI/c1-21-19(22-10-18-9-17(20)14-25-18)23-8-7-16(11-23)13-24-12-15-5-3-2-4-6-15;/h2-6,9,14,16H,7-8,10-13H2,1H3,(H,21,22);1H |
| InChIKey | BJLKAFZFSRMOKY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|