C27H32N4O2 — CID 111526272
N'-methyl-3-(phenylmethoxymethyl)-N-[(2-phenylmethoxy-4-pyridinyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111526272) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N'-methyl-3-(phenylmethoxymethyl)-N-[(2-phenylmethoxy-4-pyridinyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(phenylmethoxymethyl)-N-[(2-phenylmethoxy-4-pyridinyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111526272 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N'-methyl-3-(phenylmethoxymethyl)-N-[(2-phenylmethoxy-4-pyridinyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccnc(OCc2ccccc2)c1)N1CCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C27H32N4O2/c1-28-27(31-15-13-25(18-31)20-32-19-22-8-4-2-5-9-22)30-17-24-12-14-29-26(16-24)33-21-23-10-6-3-7-11-23/h2-12,14,16,25H,13,15,17-21H2,1H3,(H,28,30) |
| InChIKey | UFCGQEBVPZJYHK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|