C18H27F3IN3O3 — CID 111736030
3-(methoxymethyl)-N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111736030) has the molecular formula C18H27F3IN3O3 and a molecular weight of 517.33 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111736030 |
| Molecular Formula | C18H27F3IN3O3 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 3-(methoxymethyl)-N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)c(OC)c1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C18H26F3N3O3.HI/c1-22-17(24-7-6-14(10-24)11-25-2)23-9-13-4-5-15(16(8-13)26-3)27-12-18(19,20)21;/h4-5,8,14H,6-7,9-12H2,1-3H3,(H,22,23);1H |
| InChIKey | JIHRAIHHFJQPDW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|