C16H24BrN3O2 — CID 111737407
N-[(5-bromo-2-methoxyphenyl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111737407) has the molecular formula C16H24BrN3O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111737407 |
| Molecular Formula | C16H24BrN3O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cc(Br)ccc1OC)N1CCC(COC)C1 |
| InChI | InChI=1S/C16H24BrN3O2/c1-18-16(20-7-6-12(10-20)11-21-2)19-9-13-8-14(17)4-5-15(13)22-3/h4-5,8,12H,6-7,9-11H2,1-3H3,(H,18,19) |
| InChIKey | VWAKJSXGLQYBRY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|