C17H25BrN4O2 — CID 119143468
N-(5-bromo-2-methylphenyl)-2-[[C-[3-(methoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]acetamide (PubChem CID 119143468) has the molecular formula C17H25BrN4O2 and a molecular weight of 397.32 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[C-[3-(methoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]acetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[C-[3-(methoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119143468 |
| Molecular Formula | C17H25BrN4O2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[C-[3-(methoxymethyl)pyrrolidin-1-yl]-N-methylcarbonimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCC(=O)Nc1cc(Br)ccc1C)N1CCC(COC)C1 |
| InChI | InChI=1S/C17H25BrN4O2/c1-12-4-5-14(18)8-15(12)21-16(23)9-20-17(19-2)22-7-6-13(10-22)11-24-3/h4-5,8,13H,6-7,9-11H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | LENKVOJAIDBDHJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|