C14H21BrClN3O3 — CID 119762977
N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119762977) has the molecular formula C14H21BrClN3O3 and a molecular weight of 394.70 g/mol. Its IUPAC name is N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119762977 |
| Molecular Formula | C14H21BrClN3O3 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCC(=O)Nc1cc(Br)ccc1C.Cl |
| InChI | InChI=1S/C14H20BrN3O3.ClH/c1-10-3-4-11(15)7-12(10)18-14(20)9-17-13(19)8-16-5-6-21-2;/h3-4,7,16H,5-6,8-9H2,1-2H3,(H,17,19)(H,18,20);1H |
| InChIKey | NYUBCBDDWHBBEM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|