C17H25BrN4OS — CID 109488608
N-(5-bromo-2-methylphenyl)-2-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]acetamide (PubChem CID 109488608) has the molecular formula C17H25BrN4OS and a molecular weight of 413.39 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]acetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109488608 |
| Molecular Formula | C17H25BrN4OS |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cc(Br)ccc1C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H25BrN4OS/c1-12-5-6-13(18)9-14(12)21-15(23)10-20-16(19-4)22-7-8-24-17(2,3)11-22/h5-6,9H,7-8,10-11H2,1-4H3,(H,19,20)(H,21,23) |
| InChIKey | YGGGTLQYJWSATH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|