C12H23N3O2S — CID 109487837
methyl 3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanoate (PubChem CID 109487837) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is methyl 3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 109487837 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl 3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C12H23N3O2S/c1-12(2)9-15(7-8-18-12)11(13-3)14-6-5-10(16)17-4/h5-9H2,1-4H3,(H,13,14) |
| InChIKey | CWLHOFBMWYQTLM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|