C18H37N5S — CID 109488574
N-[4-(4-ethylpiperazin-1-yl)butyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109488574) has the molecular formula C18H37N5S and a molecular weight of 355.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)butyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488574 |
| Molecular Formula | C18H37N5S |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN1CCN(CCCCN/C(=N\C)N2CCSC(C)(C)C2)CC1 |
| InChI | InChI=1S/C18H37N5S/c1-5-21-10-12-22(13-11-21)9-7-6-8-20-17(19-4)23-14-15-24-18(2,3)16-23/h5-16H2,1-4H3,(H,19,20) |
| InChIKey | CUAPMICNXJFLSB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|