C18H36N4S — CID 109489557
N',2,2-trimethyl-N-[4-(4-methylpiperidin-1-yl)butyl]thiomorpholine-4-carboximidamide (PubChem CID 109489557) has the molecular formula C18H36N4S and a molecular weight of 340.58 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[4-(4-methylpiperidin-1-yl)butyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[4-(4-methylpiperidin-1-yl)butyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489557 |
| Molecular Formula | C18H36N4S |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | N',2,2-trimethyl-N-[4-(4-methylpiperidin-1-yl)butyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCC(C)CC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H36N4S/c1-16-7-11-21(12-8-16)10-6-5-9-20-17(19-4)22-13-14-23-18(2,3)15-22/h16H,5-15H2,1-4H3,(H,19,20) |
| InChIKey | OVEQBXGLWZVHFU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|