C13H26IN3S — CID 109488453
N-(2-cyclopropylethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488453) has the molecular formula C13H26IN3S and a molecular weight of 383.34 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-(2-cyclopropylethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488453 |
| Molecular Formula | C13H26IN3S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(2-cyclopropylethyl)-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCC1CC1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C13H25N3S.HI/c1-13(2)10-16(8-9-17-13)12(14-3)15-7-6-11-4-5-11;/h11H,4-10H2,1-3H3,(H,14,15);1H |
| InChIKey | YBSQKYLJZBIABC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|