C16H32N4S — CID 109489661
N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489661) has the molecular formula C16H32N4S and a molecular weight of 312.53 g/mol. Its IUPAC name is N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489661 |
| Molecular Formula | C16H32N4S |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCN(C(C)C)C1CC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H32N4S/c1-13(2)20(14-6-7-14)9-8-18-15(17-5)19-10-11-21-16(3,4)12-19/h13-14H,6-12H2,1-5H3,(H,17,18) |
| InChIKey | JXILMWNNOUJEFJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|