C11H21N3S — CID 109488612
N',2,2-trimethyl-N-prop-2-enylthiomorpholine-4-carboximidamide (PubChem CID 109488612) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is N',2,2-trimethyl-N-prop-2-enylthiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-prop-2-enylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488612 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N',2,2-trimethyl-N-prop-2-enylthiomorpholine-4-carboximidamide |
| SMILES | C=CCN/C(=N\C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C11H21N3S/c1-5-6-13-10(12-4)14-7-8-15-11(2,3)9-14/h5H,1,6-9H2,2-4H3,(H,12,13) |
| InChIKey | DLGJMUAHWRUJNG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|