C13H26IN3OS — CID 109489734
N',2,2-trimethyl-N-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489734) has the molecular formula C13H26IN3OS and a molecular weight of 399.34 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489734 |
| Molecular Formula | C13H26IN3OS |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N',2,2-trimethyl-N-[(3-methyloxetan-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1(C)COC1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C13H25N3OS.HI/c1-12(2)8-16(5-6-18-12)11(14-4)15-7-13(3)9-17-10-13;/h5-10H2,1-4H3,(H,14,15);1H |
| InChIKey | ONRJPIGALBFLEH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|