C13H28IN3S — CID 109487450
N',2,2-trimethyl-N-pentylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487450) has the molecular formula C13H28IN3S and a molecular weight of 385.36 g/mol. Its IUPAC name is N',2,2-trimethyl-N-pentylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N',2,2-trimethyl-N-pentylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487450 |
| Molecular Formula | C13H28IN3S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N',2,2-trimethyl-N-pentylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCCCCN/C(=N\C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C13H27N3S.HI/c1-5-6-7-8-15-12(14-4)16-9-10-17-13(2,3)11-16;/h5-11H2,1-4H3,(H,14,15);1H |
| InChIKey | IHDIESJTIKYKHQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|