C17H36N4S — CID 109489551
N-[7-(dimethylamino)heptyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489551) has the molecular formula C17H36N4S and a molecular weight of 328.57 g/mol. Its IUPAC name is N-[7-(dimethylamino)heptyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[7-(dimethylamino)heptyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489551 |
| Molecular Formula | C17H36N4S |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | N-[7-(dimethylamino)heptyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCCCCCCN(C)C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H36N4S/c1-17(2)15-21(13-14-22-17)16(18-3)19-11-9-7-6-8-10-12-20(4)5/h6-15H2,1-5H3,(H,18,19) |
| InChIKey | CNXUJKHPSKXDRA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|