C17H34N4OS — CID 109489077
N',2,2-trimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide (PubChem CID 109489077) has the molecular formula C17H34N4OS and a molecular weight of 342.55 g/mol. Its IUPAC name is N',2,2-trimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489077 |
| Molecular Formula | C17H34N4OS |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N',2,2-trimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCC(C(C)C)N1CCOCC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H34N4OS/c1-14(2)15(20-6-9-22-10-7-20)12-19-16(18-5)21-8-11-23-17(3,4)13-21/h14-15H,6-13H2,1-5H3,(H,18,19) |
| InChIKey | GUGSMVDQONVMFJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|