C14H27N3S2 — CID 109487835
N-ethyl-2,2-dimethyl-N'-(2-prop-2-enylsulfanylethyl)thiomorpholine-4-carboximidamide (PubChem CID 109487835) has the molecular formula C14H27N3S2 and a molecular weight of 301.53 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-(2-prop-2-enylsulfanylethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-(2-prop-2-enylsulfanylethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487835 |
| Molecular Formula | C14H27N3S2 |
| Molecular Weight | 301.53 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-(2-prop-2-enylsulfanylethyl)thiomorpholine-4-carboximidamide |
| SMILES | C=CCSCC/N=C(\NCC)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C14H27N3S2/c1-5-9-18-10-7-16-13(15-6-2)17-8-11-19-14(3,4)12-17/h5H,1,6-12H2,2-4H3,(H,15,16) |
| InChIKey | UZYSEEXNYPGCFW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|