C16H31IN4OS — CID 109487892
N-cyclopropyl-4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanamide;hydroiodide (PubChem CID 109487892) has the molecular formula C16H31IN4OS and a molecular weight of 454.42 g/mol. Its IUPAC name is N-cyclopropyl-4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 109487892 |
| Molecular Formula | C16H31IN4OS |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-cyclopropyl-4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C16H30N4OS.HI/c1-4-17-15(20-10-11-22-16(2,3)12-20)18-9-5-6-14(21)19-13-7-8-13;/h13H,4-12H2,1-3H3,(H,17,18)(H,19,21);1H |
| InChIKey | AHQPJZXRRDLWIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|