C22H34N4O2S — CID 109487999
N-cyclopropyl-2-[4-[2-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide (PubChem CID 109487999) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 109487999 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\CCc1ccc(OCC(=O)NC2CC2)cc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C22H34N4O2S/c1-4-23-21(26-13-14-29-22(2,3)16-26)24-12-11-17-5-9-19(10-6-17)28-15-20(27)25-18-7-8-18/h5-6,9-10,18H,4,7-8,11-16H2,1-3H3,(H,23,24)(H,25,27) |
| InChIKey | ZEWGWSNVTXYAKS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|