C17H32N4OS — CID 109489825
N-cyclopentyl-3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]propanamide (PubChem CID 109489825) has the molecular formula C17H32N4OS and a molecular weight of 340.54 g/mol. Its IUPAC name is N-cyclopentyl-3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]propanamide.
| Compound Name | N-cyclopentyl-3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 109489825 |
| Molecular Formula | C17H32N4OS |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-cyclopentyl-3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCCC1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H32N4OS/c1-4-18-16(21-11-12-23-17(2,3)13-21)19-10-9-15(22)20-14-7-5-6-8-14/h14H,4-13H2,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | PDZSWJASVAQSNC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|