C16H31IN4O3S2 — CID 109489976
3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide (PubChem CID 109489976) has the molecular formula C16H31IN4O3S2 and a molecular weight of 518.49 g/mol. Its IUPAC name is 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide.
| Compound Name | 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 109489976 |
| Molecular Formula | C16H31IN4O3S2 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C16H30N4O3S2.HI/c1-4-17-15(20-8-9-24-16(2,3)12-20)18-7-5-14(21)19-13-6-10-25(22,23)11-13;/h13H,4-12H2,1-3H3,(H,17,18)(H,19,21);1H |
| InChIKey | MGMSZWRPNBJFLW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|