C18H34IN5O5S — CID 111328419
ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328419) has the molecular formula C18H34IN5O5S and a molecular weight of 559.47 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328419 |
| Molecular Formula | C18H34IN5O5S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C18H33N5O5S.HI/c1-3-19-17(22-14-6-10-23(11-7-14)18(25)28-4-2)20-9-5-16(24)21-15-8-12-29(26,27)13-15;/h14-15H,3-13H2,1-2H3,(H,21,24)(H2,19,20,22);1H |
| InChIKey | QFPODAIUDJDFQA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|