C22H36IN5O3S — CID 110986085
3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide (PubChem CID 110986085) has the molecular formula C22H36IN5O3S and a molecular weight of 577.53 g/mol. Its IUPAC name is 3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide.
| Compound Name | 3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110986085 |
| Molecular Formula | C22H36IN5O3S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 3-[[[(1-benzylpiperidin-4-yl)amino]-(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H35N5O3S.HI/c1-2-23-22(24-12-8-21(28)25-20-11-15-31(29,30)17-20)26-19-9-13-27(14-10-19)16-18-6-4-3-5-7-18;/h3-7,19-20H,2,8-17H2,1H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | LHNDYFUOYLALQR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|