C17H25N3O3S — CID 30726667
2-(4-benzylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 30726667) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 30726667 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(18-16-6-11-24(22,23)14-16)13-20-9-7-19(8-10-20)12-15-4-2-1-3-5-15/h1-5,16H,6-14H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | DKVCGZKWSRHEFU-MRXNPFEDSA-N |
| XLogP | 0.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |