C12H15NO3S — CID 40569648
N-[(3S)-1,1-dioxothiolan-3-yl]-2-phenylacetamide (PubChem CID 40569648) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-phenylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 40569648 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO3S/c14-12(8-10-4-2-1-3-5-10)13-11-6-7-17(15,16)9-11/h1-5,11H,6-9H2,(H,13,14)/t11-/m0/s1 |
| InChIKey | IIAOMJPEQNIIDO-NSHDSACASA-N |
| XLogP | 0.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |