C16H17NO3S — CID 27710322
N-[(3R)-1,1-dioxothiolan-3-yl]-2-naphthalen-1-ylacetamide (PubChem CID 27710322) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 27710322 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17NO3S/c18-16(17-14-8-9-21(19,20)11-14)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-7,14H,8-11H2,(H,17,18)/t14-/m1/s1 |
| InChIKey | BVYRSBOXPKWMOK-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |