C15H15NO — CID 976036
N-cyclopropyl-2-naphthalen-1-ylacetamide (PubChem CID 976036) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is N-cyclopropyl-2-naphthalen-1-ylacetamide.
| Compound Name | N-cyclopropyl-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 976036 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-cyclopropyl-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NC1CC1 |
| InChI | InChI=1S/C15H15NO/c17-15(16-13-8-9-13)10-12-6-3-5-11-4-1-2-7-14(11)12/h1-7,13H,8-10H2,(H,16,17) |
| InChIKey | AODJPSKKHFEVIQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |