C17H21ClN2O — CID 119427587
2-naphthalen-1-yl-N-piperidin-3-ylacetamide;hydrochloride (PubChem CID 119427587) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-piperidin-3-ylacetamide;hydrochloride.
| Compound Name | 2-naphthalen-1-yl-N-piperidin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119427587 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-naphthalen-1-yl-N-piperidin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1cccc2ccccc12)NC1CCCNC1 |
| InChI | InChI=1S/C17H20N2O.ClH/c20-17(19-15-8-4-10-18-12-15)11-14-7-3-6-13-5-1-2-9-16(13)14;/h1-3,5-7,9,15,18H,4,8,10-12H2,(H,19,20);1H |
| InChIKey | XIDBZRLHJCDMKO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |