C17H21ClN2O2 — CID 119426850
2-naphthalen-1-yloxy-N-piperidin-3-ylacetamide;hydrochloride (PubChem CID 119426850) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-N-piperidin-3-ylacetamide;hydrochloride.
| Compound Name | 2-naphthalen-1-yloxy-N-piperidin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119426850 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-naphthalen-1-yloxy-N-piperidin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(COc1cccc2ccccc12)NC1CCCNC1 |
| InChI | InChI=1S/C17H20N2O2.ClH/c20-17(19-14-7-4-10-18-11-14)12-21-16-9-3-6-13-5-1-2-8-15(13)16;/h1-3,5-6,8-9,14,18H,4,7,10-12H2,(H,19,20);1H |
| InChIKey | TZAFJXAMNGYRED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |