C20H22N2O3 — CID 119426216
2-(4-benzoylphenoxy)-N-piperidin-3-ylacetamide (PubChem CID 119426216) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-piperidin-3-ylacetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 119426216 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-piperidin-3-ylacetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)NC1CCCNC1 |
| InChI | InChI=1S/C20H22N2O3/c23-19(22-17-7-4-12-21-13-17)14-25-18-10-8-16(9-11-18)20(24)15-5-2-1-3-6-15/h1-3,5-6,8-11,17,21H,4,7,12-14H2,(H,22,23) |
| InChIKey | DPMHRRZJBBZOLA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |