C21H25ClN2O3 — CID 120600141
2-(4-benzoylphenoxy)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride (PubChem CID 120600141) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride.
| Compound Name | 2-(4-benzoylphenoxy)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120600141 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
| SMILES | CC1CC(NC(=O)COc2ccc(C(=O)c3ccccc3)cc2)CCN1.Cl |
| InChI | InChI=1S/C21H24N2O3.ClH/c1-15-13-18(11-12-22-15)23-20(24)14-26-19-9-7-17(8-10-19)21(25)16-5-3-2-4-6-16;/h2-10,15,18,22H,11-14H2,1H3,(H,23,24);1H |
| InChIKey | JVJBXCOTYMXFRO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |